Products 87329-50-8

CAS 87329-50-8 appears in our catalog under these names: (S)-Benzyl 2,5-diamino-5-oxopentanoate 4-methylbenzenesulfonate, 95%, (S)-Benzyl 2,5-diamino-5-oxopentanoate 4-methylbenzenesulfonate, 97%, (S)-BENZYL 2,5-DIAMINO-5-OXOPENTANOATE 4-METHYLBENZENESULFONATE, 99%, 99%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Benzyl (2S)-2,5-diamino-5-oxopentanoate;4-methylbenzenesulfonic acid (CAS 87329-50-8) is a chemical compound with the molecular formula C19H24N2O6S and a molecular weight of 408.5 g/mol. IUPAC name: benzyl (2S)-2,5-diamino-5-oxopentanoate;4-methylbenzenesulfonic acid. InChIKey: XREQBJVGZYBBFB-PPHPATTJSA-N.

Identity
Molecular formulaC19H24N2O6S
Molecular weight408.5 g/mol
IUPAC namebenzyl (2S)-2,5-diamino-5-oxopentanoate;4-methylbenzenesulfonic acid
InChIKeyXREQBJVGZYBBFB-PPHPATTJSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)[C@H](CCC(=O)N)N

Computed by PubChem (NCBI)