CAS 873295-32-0 appears in our catalog under these names: Glycopyrrolate Iodide(Mixture of Diastereomers), >95% (HPLC), Glycopyrronium iodide-13C-D3. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, 10mg, on request.
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide (CAS 873295-32-0) is a chemical compound with the molecular formula C19H28INO3 and a molecular weight of 445.3 g/mol. IUPAC name: (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide. InChIKey: MDXIQDYNAVSOAZ-UHFFFAOYSA-M.
| Molecular formula | C19H28INO3 |
|---|---|
| Molecular weight | 445.3 g/mol |
| IUPAC name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide |
| InChIKey | MDXIQDYNAVSOAZ-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCC(C1)OC(=O)C(C2CCCC2)(C3=CC=CC=C3)O)C.[I-] |
Computed by PubChem (NCBI)