CAS 873397-19-4 appears in our catalog under these names: 2-Amino-6-(chloromethyl)-4(3H)-pteridinone (>90%), Folic Acid Impurity 14. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, 50mg, on request.
2-amino-6-(chloromethyl)-3H-pteridin-4-one (CAS 873397-19-4) is a chemical compound with the molecular formula C7H6ClN5O and a molecular weight of 211.61 g/mol. IUPAC name: 2-amino-6-(chloromethyl)-3H-pteridin-4-one. InChIKey: ZLTBATTVDKFEDZ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5O |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 2-amino-6-(chloromethyl)-3H-pteridin-4-one |
| InChIKey | ZLTBATTVDKFEDZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=O)NC(=NC2=N1)N)CCl |
Computed by PubChem (NCBI)