Products 87340-25-8
CAS 87340-25-8 is the registry number for Fortuneine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,13,15-pentaene (CAS 87340-25-8) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 327.4 g/mol. IUPAC name: (1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,13,15-pentaene. InChIKey: FCYJGRFDMUVIHS-UZLBHIALSA-N.
| Molecular formula | C20H25NO3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,13,15-pentaene |
| InChIKey | FCYJGRFDMUVIHS-UZLBHIALSA-N |
| SMILES | CO[C@H]1C[C@@]23C(=CCN2CCCC4=CC(=C(C=C34)OC)OC)C=C1 |
Computed by PubChem (NCBI)
Synonyms:
Fortuneine, orb1682555