CAS 873436-88-5 is the registry number for 8-(Benzo[d][1,3]dioxol-5-ylthio)-9H-purin-6-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(1,3-benzodioxol-5-ylsulfanyl)-7H-purin-6-amine (CAS 873436-88-5) is a chemical compound with the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. IUPAC name: 8-(1,3-benzodioxol-5-ylsulfanyl)-7H-purin-6-amine. InChIKey: LGBDNSGYOVMKIT-UHFFFAOYSA-N.
| Molecular formula | C12H9N5O2S |
|---|---|
| Molecular weight | 287.30 g/mol |
| IUPAC name | 8-(1,3-benzodioxol-5-ylsulfanyl)-7H-purin-6-amine |
| InChIKey | LGBDNSGYOVMKIT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)SC3=NC4=NC=NC(=C4N3)N |
Computed by PubChem (NCBI)