CAS 873436-89-6 is the registry number for 8-((6-Iodo-1,3-benzodioxol-5-yl)thio)-9H-purin-6-amine. Offered by: TRC. Available pack sizes: 500mg.
8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-6-amine (CAS 873436-89-6) is a chemical compound with the molecular formula C12H8IN5O2S and a molecular weight of 413.20 g/mol. IUPAC name: 8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-6-amine. InChIKey: BFOWGJNWQLLISB-UHFFFAOYSA-N.
| Molecular formula | C12H8IN5O2S |
|---|---|
| Molecular weight | 413.20 g/mol |
| IUPAC name | 8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-6-amine |
| InChIKey | BFOWGJNWQLLISB-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(=C(C=C2O1)I)SC3=NC4=NC=NC(=C4N3)N |
Computed by PubChem (NCBI)