CAS 873453-82-8 appears in our catalog under these names: 2-(4-Nitro-3-(trifluoromethyl)phenoxy)ethan-1-ol, 95%, 2-(4-Nitro-3-(trifluoromethyl)phenoxy)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanol (CAS 873453-82-8) is a chemical compound with the molecular formula C9H8F3NO4 and a molecular weight of 251.16 g/mol. IUPAC name: 2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanol. InChIKey: QFDJIYCXXRQKQS-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO4 |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | 2-[4-nitro-3-(trifluoromethyl)phenoxy]ethanol |
| InChIKey | QFDJIYCXXRQKQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCCO)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)