CAS 873671-24-0 is the registry number for ethyl 4-((4-chloro-3-nitrophenyl)sulfonyl)piperazinecarboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl 4-(4-chloro-3-nitrophenyl)sulfonylpiperazine-1-carboxylate (CAS 873671-24-0) is a chemical compound with the molecular formula C13H16ClN3O6S and a molecular weight of 377.80 g/mol. IUPAC name: ethyl 4-(4-chloro-3-nitrophenyl)sulfonylpiperazine-1-carboxylate. InChIKey: JKVSAGFVLQQYDY-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O6S |
|---|---|
| Molecular weight | 377.80 g/mol |
| IUPAC name | ethyl 4-(4-chloro-3-nitrophenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | JKVSAGFVLQQYDY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)