CAS 873675-36-6 is the registry number for (2-thienylmethyl)((2,4,5-trichlorophenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
2,4,5-trichloro-N-(thiophen-2-ylmethyl)benzenesulfonamide (CAS 873675-36-6) is a chemical compound with the molecular formula C11H8Cl3NO2S2 and a molecular weight of 356.7 g/mol. IUPAC name: 2,4,5-trichloro-N-(thiophen-2-ylmethyl)benzenesulfonamide. InChIKey: DNXHYHWZTFWZSP-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl3NO2S2 |
|---|---|
| Molecular weight | 356.7 g/mol |
| IUPAC name | 2,4,5-trichloro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| InChIKey | DNXHYHWZTFWZSP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CNS(=O)(=O)C2=CC(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)