CAS 873675-56-0 is the registry number for (4-pyridylmethyl)((2,4,5-trichlorophenyl)sulphonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
2,4,5-trichloro-N-(pyridin-4-ylmethyl)benzenesulfonamide (CAS 873675-56-0) is a chemical compound with the molecular formula C12H9Cl3N2O2S and a molecular weight of 351.6 g/mol. IUPAC name: 2,4,5-trichloro-N-(pyridin-4-ylmethyl)benzenesulfonamide. InChIKey: FBGBPQAUBKKRGH-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl3N2O2S |
|---|---|
| Molecular weight | 351.6 g/mol |
| IUPAC name | 2,4,5-trichloro-N-(pyridin-4-ylmethyl)benzenesulfonamide |
| InChIKey | FBGBPQAUBKKRGH-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1CNS(=O)(=O)C2=CC(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)