CAS 873693-47-1 is the registry number for NBI-75043. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-dimethyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine (CAS 873693-47-1) is a chemical compound with the molecular formula C19H22N2S and a molecular weight of 310.5 g/mol. IUPAC name: N,N-dimethyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine. InChIKey: NANQRVOKMXDMNL-AWEZNQCLSA-N.
| Molecular formula | C19H22N2S |
|---|---|
| Molecular weight | 310.5 g/mol |
| IUPAC name | N,N-dimethyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine |
| InChIKey | NANQRVOKMXDMNL-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=CC=N1)C2=C(SC3=CC=CC=C32)CCN(C)C |
Computed by PubChem (NCBI)