CAS 873779-30-7 appears in our catalog under these names: tert-Butyl 5-bromo-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate 95%, tert-Butyl 5-bromo-2-oxospiro[3H-indoline-3,4'-piperidine]-1'-carboxylate, 95%, 95%, 1'-Boc-5-Bromo-1,2-dihydro-2-oxo-spiro[3H-indole-3,4'-piperidine], 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg.
Tert-butyl 5-bromo-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 873779-30-7) is a chemical compound with the molecular formula C17H21BrN2O3 and a molecular weight of 381.3 g/mol. IUPAC name: tert-butyl 5-bromo-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: SMSXNHRWSYLACX-UHFFFAOYSA-N.
| Molecular formula | C17H21BrN2O3 |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | SMSXNHRWSYLACX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=CC(=C3)Br)NC2=O |
Computed by PubChem (NCBI)