CAS 873928-71-3 appears in our catalog under these names: 2-(Bismethyl)aminomethylcyclohexanone-d6, 2-((Dimethylamino)methyl)cyclohexanone-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 100 mg, 1 g, 500 mg.
2-[[bis(trideuteriomethyl)amino]methyl]cyclohexan-1-one (CAS 873928-71-3) is a chemical compound with the molecular formula C9H17NO and a molecular weight of 161.27 g/mol. IUPAC name: 2-[[bis(trideuteriomethyl)amino]methyl]cyclohexan-1-one. InChIKey: QDHLEFBSGUGHCL-WFGJKAKNSA-N.
| Molecular formula | C9H17NO |
|---|---|
| Molecular weight | 161.27 g/mol |
| IUPAC name | 2-[[bis(trideuteriomethyl)amino]methyl]cyclohexan-1-one |
| InChIKey | QDHLEFBSGUGHCL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CC1CCCCC1=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)