Products 873928-72-4
CAS 873928-72-4 appears in our catalog under these names: 3–(Methoxy–d3)–bromobenzene, 1-Bromo-3-methoxybenzene-d3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 20mg, 1 g, 100 mg, 500 mg, 250 mg.
1-bromo-3-(trideuteriomethoxy)benzene (CAS 873928-72-4) is a chemical compound with the molecular formula C7H7BrO and a molecular weight of 190.05 g/mol. IUPAC name: 1-bromo-3-(trideuteriomethoxy)benzene. InChIKey: PLDWAJLZAAHOGG-FIBGUPNXSA-N.
| Molecular formula | C7H7BrO |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 1-bromo-3-(trideuteriomethoxy)benzene |
| InChIKey | PLDWAJLZAAHOGG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)