CAS 87394-52-3 is the registry number for 2-(1-Piperazinyl)nicotinamide dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-piperazin-1-ylpyridine-3-carboxamide;dihydrochloride (CAS 87394-52-3) is a chemical compound with the molecular formula C10H16Cl2N4O and a molecular weight of 279.16 g/mol. IUPAC name: 2-piperazin-1-ylpyridine-3-carboxamide;dihydrochloride. InChIKey: RKOAMAYITCGTTH-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N4O |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 2-piperazin-1-ylpyridine-3-carboxamide;dihydrochloride |
| InChIKey | RKOAMAYITCGTTH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC=N2)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)