CAS 874136-23-9 appears in our catalog under these names: 3-tert-Butyl-1-isopropyl-1h-pyrazol-5-amine, 95%, 3-(tert-Butyl)-1-isopropyl-1H-pyrazol-5-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-tert-butyl-1-propan-2-ylpyrazol-5-amine (CAS 874136-23-9) is a chemical compound with the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. IUPAC name: 3-tert-butyl-1-propan-2-ylpyrazol-5-amine. InChIKey: LKVWGCCYXJIDKG-UHFFFAOYSA-N.
| Molecular formula | C10H19N3 |
|---|---|
| Molecular weight | 181.28 g/mol |
| IUPAC name | 3-tert-butyl-1-propan-2-ylpyrazol-5-amine |
| InChIKey | LKVWGCCYXJIDKG-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=CC(=N1)C(C)(C)C)N |
Computed by PubChem (NCBI)