CAS 874208-92-1 appears in our catalog under these names: 2,5-Dioxo-1-pyrrolidinyl 4,7,10,13,16,19,22-heptaoxatricosanoate, 95%+, 95%+, m-PEG7 NHS ester, 95%, m–PEG7–NHS ester, m-PEG7-NHS ester 98%, m-PEG7-NHS ester. Offered by: Chemat, Combi-blocks, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg, 50 mg, 100 mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 874208-92-1) is a chemical compound with the molecular formula C20H35NO11 and a molecular weight of 465.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: WFZQJHMGKLLCOJ-UHFFFAOYSA-N.
| Molecular formula | C20H35NO11 |
|---|---|
| Molecular weight | 465.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | WFZQJHMGKLLCOJ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)