CAS 874292-66-7 is the registry number for (2AS,8bS)-1,3,4,8b-tetrahydronaphtho[1,2-b]azet-2(2aH)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2aS,8bS)-2a,3,4,8b-tetrahydro-1H-naphtho[1,2-b]azet-2-one (CAS 874292-66-7) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: (2aS,8bS)-2a,3,4,8b-tetrahydro-1H-naphtho[1,2-b]azet-2-one. InChIKey: RVCIXYMGIRZTFA-VHSXEESVSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2aS,8bS)-2a,3,4,8b-tetrahydro-1H-naphtho[1,2-b]azet-2-one |
| InChIKey | RVCIXYMGIRZTFA-VHSXEESVSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]3[C@H]1C(=O)N3 |
Computed by PubChem (NCBI)