CAS 874293-84-2 is the registry number for (1R,2S)-2-Aminocyclohexane-1-carbonitrile, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
Trans-(1R,2S)-2-aminocyclohexane-1-carbonitrile (CAS 874293-84-2) is a chemical compound with the molecular formula C7H12N2 and a molecular weight of 124.18 g/mol. IUPAC name: trans-(1R,2S)-2-aminocyclohexane-1-carbonitrile. InChIKey: RVGOKHBYNZPVGI-BQBZGAKWSA-N.
| Molecular formula | C7H12N2 |
|---|---|
| Molecular weight | 124.18 g/mol |
| IUPAC name | trans-(1R,2S)-2-aminocyclohexane-1-carbonitrile |
| InChIKey | RVGOKHBYNZPVGI-BQBZGAKWSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C#N)N |
Computed by PubChem (NCBI)