CAS 874460-04-5 appears in our catalog under these names: 4-(thiophen-2-ylmethylcarbamoyl)phenylboronic acid, 95%, B–(4–(((2–thienylmethyl)amino)carbonyl)phenyl)Boronic acid, (4-((Thiophen-2-ylmethyl)carbamoyl)phenyl)boronic acid, 95%, 95%, (4-((Thiophen-2-ylmethyl)carbamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 50mg.
[4-(thiophen-2-ylmethylcarbamoyl)phenyl]boronic acid (CAS 874460-04-5) is a chemical compound with the molecular formula C12H12BNO3S and a molecular weight of 261.11 g/mol. IUPAC name: [4-(thiophen-2-ylmethylcarbamoyl)phenyl]boronic acid. InChIKey: NOPRZKVMGDJBDW-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3S |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | [4-(thiophen-2-ylmethylcarbamoyl)phenyl]boronic acid |
| InChIKey | NOPRZKVMGDJBDW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC2=CC=CS2)(O)O |
Computed by PubChem (NCBI)