Products 874583-32-1
CAS 874583-32-1 is the registry number for Methyl 5-(2-(Methylsulfamoyl)ethyl)-3-(4-pyridyl)-1H-indole-2-carboxylate. Offered by: TRC. Available pack sizes: 500mg.
Methyl 5-[2-(methylsulfamoyl)ethyl]-3-pyridin-4-yl-1H-indole-2-carboxylate (CAS 874583-32-1) is a chemical compound with the molecular formula C18H19N3O4S and a molecular weight of 373.4 g/mol. IUPAC name: methyl 5-[2-(methylsulfamoyl)ethyl]-3-pyridin-4-yl-1H-indole-2-carboxylate. InChIKey: IFJMJRSGQQOANI-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O4S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | methyl 5-[2-(methylsulfamoyl)ethyl]-3-pyridin-4-yl-1H-indole-2-carboxylate |
| InChIKey | IFJMJRSGQQOANI-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CCC1=CC2=C(C=C1)NC(=C2C3=CC=NC=C3)C(=O)OC |
Computed by PubChem (NCBI)