CAS 87459-72-1 appears in our catalog under these names: H-Arg-otbu dihydrochloride, 95%, H-Arg-OtBu dihydrochloride, 98%, H–Arg–OtBu·2HCl, H-L-Arg-OtBu*2HCl, L-Arginine-tert-butyl ester dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1g, 250mg, 5g, 25g, 2000mg, 1000mg, 5000mg, 10000mg.
Tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (CAS 87459-72-1) is a chemical compound with the molecular formula C10H24Cl2N4O2 and a molecular weight of 303.23 g/mol. IUPAC name: tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride. InChIKey: QTFOKKSRMYGTQT-KLXURFKVSA-N.
| Molecular formula | C10H24Cl2N4O2 |
|---|---|
| Molecular weight | 303.23 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| InChIKey | QTFOKKSRMYGTQT-KLXURFKVSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCN=C(N)N)N.Cl.Cl |
Computed by PubChem (NCBI)