CAS 874591-56-7 is the registry number for 3-(3-Ethyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylaniline (CAS 874591-56-7) is a chemical compound with the molecular formula C12H13N5S and a molecular weight of 259.33 g/mol. IUPAC name: 3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylaniline. InChIKey: JYGYVJGKVKTAIH-UHFFFAOYSA-N.
| Molecular formula | C12H13N5S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylaniline |
| InChIKey | JYGYVJGKVKTAIH-UHFFFAOYSA-N |
| SMILES | CCC1=NN=C2N1N=C(S2)C3=C(C(=CC=C3)N)C |
Computed by PubChem (NCBI)