CAS 874593-97-2 appears in our catalog under these names: 5-(1,1-Dioxidotetrahydrothien-3-yl)-2-thioxodihydropyrimidine-4,6(1h,5h)-dione, 95%, 5-(1,1-Dioxo-1λâ¶-thiolan-3-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 874593-97-2) is a chemical compound with the molecular formula C8H10N2O4S2 and a molecular weight of 262.3 g/mol. IUPAC name: 5-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: ZZEKATLNQBNWOE-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 5-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | ZZEKATLNQBNWOE-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1C2C(=O)NC(=S)NC2=O |
Computed by PubChem (NCBI)