Products 874594-03-3
CAS 874594-03-3 is the registry number for 5-(Pyrrolidine-1-sulfonyl)-2,3-dihydro-1H-indole. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-pyrrolidin-1-ylsulfonyl-2,3-dihydro-1H-indole (CAS 874594-03-3) is a chemical compound with the molecular formula C12H16N2O2S and a molecular weight of 252.33 g/mol. IUPAC name: 5-pyrrolidin-1-ylsulfonyl-2,3-dihydro-1H-indole. InChIKey: WSDYMOFKGXULNK-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2S |
|---|---|
| Molecular weight | 252.33 g/mol |
| IUPAC name | 5-pyrrolidin-1-ylsulfonyl-2,3-dihydro-1H-indole |
| InChIKey | WSDYMOFKGXULNK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC3=C(C=C2)NCC3 |
Computed by PubChem (NCBI)