CAS 87462-63-3 appears in our catalog under these names: 6-Heptyn-1-ol, 4-methylbenzenesulfonate, 95%, 95%, Hept-6-yn-1-yl 4-methylbenzenesulfonate, 98.51%, Hept-6-yn-1-yl 4-methylbenzenesulfonate, 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500 mg, 1 g, 250 mg.
Hept-6-ynyl 4-methylbenzenesulfonate (CAS 87462-63-3) is a chemical compound with the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. IUPAC name: hept-6-ynyl 4-methylbenzenesulfonate. InChIKey: XYHZCWQGARGTDB-UHFFFAOYSA-N.
| Molecular formula | C14H18O3S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | hept-6-ynyl 4-methylbenzenesulfonate |
| InChIKey | XYHZCWQGARGTDB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCCC#C |
Computed by PubChem (NCBI)