CAS 874767-60-9 appears in our catalog under these names: 3-Fluoro-4-methoxybenzenesulfonamide, 95%, 3-Fluoro-4-methoxybenzenesulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 500mg, 2g, 25g, 1g, 10g.
3-fluoro-4-methoxybenzenesulfonamide (CAS 874767-60-9) is a chemical compound with the molecular formula C7H8FNO3S and a molecular weight of 205.21 g/mol. IUPAC name: 3-fluoro-4-methoxybenzenesulfonamide. InChIKey: JCPWNWBBZNNHDW-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO3S |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 3-fluoro-4-methoxybenzenesulfonamide |
| InChIKey | JCPWNWBBZNNHDW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N)F |
Computed by PubChem (NCBI)