CAS 874784-07-3 is the registry number for 5-(3-Fluoro-5-(trifluoromethyl)phenyl)-2H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[3-fluoro-5-(trifluoromethyl)phenyl]-2H-tetrazole (CAS 874784-07-3) is a chemical compound with the molecular formula C8H4F4N4 and a molecular weight of 232.14 g/mol. IUPAC name: 5-[3-fluoro-5-(trifluoromethyl)phenyl]-2H-tetrazole. InChIKey: AUWAJKSIVFUQBM-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N4 |
|---|---|
| Molecular weight | 232.14 g/mol |
| IUPAC name | 5-[3-fluoro-5-(trifluoromethyl)phenyl]-2H-tetrazole |
| InChIKey | AUWAJKSIVFUQBM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)C2=NNN=N2 |
Computed by PubChem (NCBI)