CAS 874794-87-3 is the registry number for 6-Chloro-4-(phenylsulfonyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(benzenesulfonyl)-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 874794-87-3) is a chemical compound with the molecular formula C15H12ClNO5S and a molecular weight of 353.8 g/mol. IUPAC name: 4-(benzenesulfonyl)-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: HVDMEZWBKFTDHZ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO5S |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 4-(benzenesulfonyl)-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | HVDMEZWBKFTDHZ-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(N1S(=O)(=O)C3=CC=CC=C3)C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)