CAS 874800-67-6 is the registry number for 1-(4-Fluoro-2-nitrophenyl)piperidine-4-carboxamide. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-(4-fluoro-2-nitrophenyl)piperidine-4-carboxamide (CAS 874800-67-6) is a chemical compound with the molecular formula C12H14FN3O3 and a molecular weight of 267.26 g/mol. IUPAC name: 1-(4-fluoro-2-nitrophenyl)piperidine-4-carboxamide. InChIKey: KDPXKLIVMPKZSB-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3O3 |
|---|---|
| Molecular weight | 267.26 g/mol |
| IUPAC name | 1-(4-fluoro-2-nitrophenyl)piperidine-4-carboxamide |
| InChIKey | KDPXKLIVMPKZSB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N)C2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)