CAS 874800-69-8 is the registry number for 1-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]-3-piperidinecarboxylic acid. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylic acid (CAS 874800-69-8) is a chemical compound with the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.68 g/mol. IUPAC name: 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylic acid. InChIKey: FMUGSQNBMMNPKK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClF3N2O2 |
|---|---|
| Molecular weight | 308.68 g/mol |
| IUPAC name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylic acid |
| InChIKey | FMUGSQNBMMNPKK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=C(C=C(C=N2)C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)