Products 874804-26-9
CAS 874804-26-9 appears in our catalog under these names: 2-Amino-6-fluoro-3-methylbenzoic acid, 95%, 2-Amino-6-fluoro-3-methylbenzoic acid, 95-<97%, 2-Amino-6-fluoro-3-methylbenzoic acid, ≥97-<99%, 2-Amino-6-fluoro-3-methylbenzoic acid, 98%, 2–Amino–6–fluoro–3–methylbenzoic Acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 100mg.
2-amino-6-fluoro-3-methylbenzoic acid (CAS 874804-26-9) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: 2-amino-6-fluoro-3-methylbenzoic acid. InChIKey: LQGPVQQUWJIZAH-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | 2-amino-6-fluoro-3-methylbenzoic acid |
| InChIKey | LQGPVQQUWJIZAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)O)N |
Computed by PubChem (NCBI)