Products 874814-74-1
CAS 874814-74-1 is the registry number for N-(2-Iodo-4-(trifluoromethoxy)phenyl)acetamide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
N-[2-iodo-4-(trifluoromethoxy)phenyl]acetamide (CAS 874814-74-1) is a chemical compound with the molecular formula C9H7F3INO2 and a molecular weight of 345.06 g/mol. IUPAC name: N-[2-iodo-4-(trifluoromethoxy)phenyl]acetamide. InChIKey: NPPCAXNLRRVTDI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3INO2 |
|---|---|
| Molecular weight | 345.06 g/mol |
| IUPAC name | N-[2-iodo-4-(trifluoromethoxy)phenyl]acetamide |
| InChIKey | NPPCAXNLRRVTDI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC(F)(F)F)I |
Computed by PubChem (NCBI)