CAS 874817-93-3 appears in our catalog under these names: 2-Chloro-3-iodobenzoic acid, 95%, 2-Chloro-3-iodobenzoic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-3-iodobenzoic acid (CAS 874817-93-3) is a chemical compound with the molecular formula C7H4ClIO2 and a molecular weight of 282.46 g/mol. IUPAC name: 2-chloro-3-iodobenzoic acid. InChIKey: RHDAGVGRAVWMOP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClIO2 |
|---|---|
| Molecular weight | 282.46 g/mol |
| IUPAC name | 2-chloro-3-iodobenzoic acid |
| InChIKey | RHDAGVGRAVWMOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)Cl)C(=O)O |
Computed by PubChem (NCBI)