CAS 87484-87-5 appears in our catalog under these names: N-(2-Amino-2-methylpropyl)benzenesulfonamide, 95%, N–(2–Amino–2–methylpropyl)benzenesulfonamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
N-(2-amino-2-methylpropyl)benzenesulfonamide (CAS 87484-87-5) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: N-(2-amino-2-methylpropyl)benzenesulfonamide. InChIKey: MZRJFROIQYSTTC-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | N-(2-amino-2-methylpropyl)benzenesulfonamide |
| InChIKey | MZRJFROIQYSTTC-UHFFFAOYSA-N |
| SMILES | CC(C)(CNS(=O)(=O)C1=CC=CC=C1)N |
Computed by PubChem (NCBI)