Products 874882-77-6

CAS 874882-77-6 is the registry number for 3-Mercapto-2-methylpropanoic Acid 1,2-Diphenylethylamine Salt. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

1,2-diphenylethanamine;2-methyl-3-sulfanylpropanoic acid (CAS 874882-77-6) is a chemical compound with the molecular formula C18H23NO2S and a molecular weight of 317.4 g/mol. IUPAC name: 1,2-diphenylethanamine;2-methyl-3-sulfanylpropanoic acid. InChIKey: BQUPOMHBDJDBLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H23NO2S
Molecular weight317.4 g/mol
IUPAC name1,2-diphenylethanamine;2-methyl-3-sulfanylpropanoic acid
InChIKeyBQUPOMHBDJDBLJ-UHFFFAOYSA-N
SMILESCC(CS)C(=O)O.C1=CC=C(C=C1)CC(C2=CC=CC=C2)N

Computed by PubChem (NCBI)