Products 874895-87-1
CAS 874895-87-1 appears in our catalog under these names: Bilastine impurity 11, Bilastine Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4,4-dimethyl-2-(2-phenylpropan-2-yl)-5H-1,3-oxazole (CAS 874895-87-1) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: 4,4-dimethyl-2-(2-phenylpropan-2-yl)-5H-1,3-oxazole. InChIKey: NEJAUBJWBBPNGB-UHFFFAOYSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | 4,4-dimethyl-2-(2-phenylpropan-2-yl)-5H-1,3-oxazole |
| InChIKey | NEJAUBJWBBPNGB-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C(C)(C)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)