CAS 874899-05-5 appears in our catalog under these names: N-Boc-L-valinyl-L-leucinyl anilide, 98%, N-Boc-L-valinyl-L-leucinyl Anilide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
Tert-butyl N-[(2S)-1-[(1-anilino-4-methyl-1-oxopentan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 874899-05-5) is a chemical compound with the molecular formula C22H35N3O4 and a molecular weight of 405.5 g/mol. IUPAC name: tert-butyl N-[(2S)-1-[(1-anilino-4-methyl-1-oxopentan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: SSUKLQVQNUGIBO-ZVAWYAOSSA-N.
| Molecular formula | C22H35N3O4 |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-[(1-anilino-4-methyl-1-oxopentan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | SSUKLQVQNUGIBO-ZVAWYAOSSA-N |
| SMILES | CC(C)CC(C(=O)NC1=CC=CC=C1)NC(=O)[C@H](C(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)