CAS 874911-96-3 appears in our catalog under these names: Zk 756326, 95%, ZK 756326/ 99.06% (existing batch purity), ZK 756326, 2-[2-[4-[(3-Phenoxyphenyl)methyl]-1-piperazinyl]ethoxy]ethanol, 95%, 95%, ZK 756326. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
2-[2-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride (CAS 874911-96-3) is a chemical compound with the molecular formula C21H30Cl2N2O3 and a molecular weight of 429.4 g/mol. IUPAC name: 2-[2-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride. InChIKey: MPACCEKWFGWZHS-UHFFFAOYSA-N.
| Molecular formula | C21H30Cl2N2O3 |
|---|---|
| Molecular weight | 429.4 g/mol |
| IUPAC name | 2-[2-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride |
| InChIKey | MPACCEKWFGWZHS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCCO)CC2=CC(=CC=C2)OC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)