Products 874959-95-2

CAS 874959-95-2 is the registry number for [3-(4-Methoxyphenoxy)phenyl]sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-methoxyphenoxy)benzenesulfonyl chloride (CAS 874959-95-2) is a chemical compound with the molecular formula C13H11ClO4S and a molecular weight of 298.74 g/mol. IUPAC name: 3-(4-methoxyphenoxy)benzenesulfonyl chloride. InChIKey: AJOQSSVXIOABPK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClO4S
Molecular weight298.74 g/mol
IUPAC name3-(4-methoxyphenoxy)benzenesulfonyl chloride
InChIKeyAJOQSSVXIOABPK-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)OC2=CC(=CC=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)