CAS 875-83-2 appears in our catalog under these names: sodium 2–naphtholate, Sodium 2-naphtholate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 250mg, 50mg, 1g.
Sodium naphthalen-2-olate (CAS 875-83-2) is a chemical compound with the molecular formula C10H7NaO and a molecular weight of 166.15 g/mol. IUPAC name: sodium naphthalen-2-olate. InChIKey: AJXVJQAPXVDFBT-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | sodium naphthalen-2-olate |
| InChIKey | AJXVJQAPXVDFBT-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)[O-].[Na+] |
Computed by PubChem (NCBI)