CAS 875157-84-9 is the registry number for 4,5-Dibromo-N-(2-hydroxy-4-methylphenyl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dibromo-N-(2-hydroxy-4-methylphenyl)thiophene-2-carboxamide (CAS 875157-84-9) is a chemical compound with the molecular formula C12H9Br2NO2S and a molecular weight of 391.08 g/mol. IUPAC name: 4,5-dibromo-N-(2-hydroxy-4-methylphenyl)thiophene-2-carboxamide. InChIKey: FPDFVKYGMNILBX-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2NO2S |
|---|---|
| Molecular weight | 391.08 g/mol |
| IUPAC name | 4,5-dibromo-N-(2-hydroxy-4-methylphenyl)thiophene-2-carboxamide |
| InChIKey | FPDFVKYGMNILBX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC(=C(S2)Br)Br)O |
Computed by PubChem (NCBI)