CAS 875160-19-3 is the registry number for 1,5-Dimethyl-2-phenyl-4-(5-sulfanylidene-2,5-dihydro-1h-1,2,3,4-tetrazol-1-yl)-2,3-dihydro-1h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,5-dimethyl-2-phenyl-4-(5-sulfanylidene-2H-tetrazol-1-yl)pyrazol-3-one (CAS 875160-19-3) is a chemical compound with the molecular formula C12H12N6OS and a molecular weight of 288.33 g/mol. IUPAC name: 1,5-dimethyl-2-phenyl-4-(5-sulfanylidene-2H-tetrazol-1-yl)pyrazol-3-one. InChIKey: BAQBOTGOCYGUSO-UHFFFAOYSA-N.
| Molecular formula | C12H12N6OS |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 1,5-dimethyl-2-phenyl-4-(5-sulfanylidene-2H-tetrazol-1-yl)pyrazol-3-one |
| InChIKey | BAQBOTGOCYGUSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N3C(=S)N=NN3 |
Computed by PubChem (NCBI)