CAS 875160-60-4 appears in our catalog under these names: 1-(Chloroacetyl)-2-thien-2-ylpyrrolidine, 95%, 2-Chloro-1-(2-(thiophen-2-yl)pyrrolidin-1-yl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (CAS 875160-60-4) is a chemical compound with the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. IUPAC name: 2-chloro-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone. InChIKey: QTNXVJJFLBKKFL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNOS |
|---|---|
| Molecular weight | 229.73 g/mol |
| IUPAC name | 2-chloro-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| InChIKey | QTNXVJJFLBKKFL-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)CCl)C2=CC=CS2 |
Computed by PubChem (NCBI)