Products 875164-40-2
CAS 875164-40-2 is the registry number for 2-Chloro-1-(4-(2,5-dimethylbenzenesulfonyl)piperazin-1-yl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]ethanone (CAS 875164-40-2) is a chemical compound with the molecular formula C14H19ClN2O3S and a molecular weight of 330.8 g/mol. IUPAC name: 2-chloro-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]ethanone. InChIKey: YKYWKHQEHNHAJT-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O3S |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 2-chloro-1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]ethanone |
| InChIKey | YKYWKHQEHNHAJT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)N2CCN(CC2)C(=O)CCl |
Computed by PubChem (NCBI)