CAS 875241-60-4 is the registry number for Benzo(k)fluoranthene-7,12-dicarboxamide. Offered by: TRC. Available pack sizes: 2,5g.
Benzo[k]fluoranthene-7,12-dicarboxamide (CAS 875241-60-4) is a chemical compound with the molecular formula C22H14N2O2 and a molecular weight of 338.4 g/mol. IUPAC name: benzo[k]fluoranthene-7,12-dicarboxamide. InChIKey: YNBDILCSQDAXKX-UHFFFAOYSA-N.
| Molecular formula | C22H14N2O2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | benzo[k]fluoranthene-7,12-dicarboxamide |
| InChIKey | YNBDILCSQDAXKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C4=CC=CC5=C4C(=CC=C5)C3=C2C(=O)N)C(=O)N |
Computed by PubChem (NCBI)