Products 875241-83-1
CAS 875241-83-1 is the registry number for 6-Iodo-2H-benzo[b][1,4]thiazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-4H-1,4-benzothiazin-3-one (CAS 875241-83-1) is a chemical compound with the molecular formula C8H6INOS and a molecular weight of 291.11 g/mol. IUPAC name: 6-iodo-4H-1,4-benzothiazin-3-one. InChIKey: BPXVFAPSAJRFHT-UHFFFAOYSA-N.
| Molecular formula | C8H6INOS |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | 6-iodo-4H-1,4-benzothiazin-3-one |
| InChIKey | BPXVFAPSAJRFHT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)I |
Computed by PubChem (NCBI)