CAS 875245-03-7 is the registry number for 3-(3,5-Dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid (CAS 875245-03-7) is a chemical compound with the molecular formula C9H8Br2O4 and a molecular weight of 339.96 g/mol. IUPAC name: 3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid. InChIKey: KXOPOMFBWDCGJG-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O4 |
|---|---|
| Molecular weight | 339.96 g/mol |
| IUPAC name | 3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid |
| InChIKey | KXOPOMFBWDCGJG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)CC(C(=O)O)O |
Computed by PubChem (NCBI)