Products 875245-03-7

CAS 875245-03-7 is the registry number for 3-(3,5-Dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid (CAS 875245-03-7) is a chemical compound with the molecular formula C9H8Br2O4 and a molecular weight of 339.96 g/mol. IUPAC name: 3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid. InChIKey: KXOPOMFBWDCGJG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2O4
Molecular weight339.96 g/mol
IUPAC name3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid
InChIKeyKXOPOMFBWDCGJG-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Br)O)Br)CC(C(=O)O)O

Computed by PubChem (NCBI)