Products 875289-80-8

CAS 875289-80-8 is the registry number for (S)-N-(5-Amino-1-carboxypentyl)iminodiacetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g.

Structural formula: {0} (CAS {1})

(2S)-6-amino-2-[bis(carboxymethyl)amino]hexanoic acid;hydrate (CAS 875289-80-8) is a chemical compound with the molecular formula C10H20N2O7 and a molecular weight of 280.28 g/mol. IUPAC name: (2S)-6-amino-2-[bis(carboxymethyl)amino]hexanoic acid;hydrate. InChIKey: WTVPNZLAZFGAFK-FJXQXJEOSA-N.

Identity
Molecular formulaC10H20N2O7
Molecular weight280.28 g/mol
IUPAC name(2S)-6-amino-2-[bis(carboxymethyl)amino]hexanoic acid;hydrate
InChIKeyWTVPNZLAZFGAFK-FJXQXJEOSA-N
SMILESC(CCN)C[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O.O

Computed by PubChem (NCBI)