CAS 875444-06-7 appears in our catalog under these names: (4S,5S)-5-[3,5-Bis(trifluoromethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one, 95%, (4S,5S)-5-[3,5-Bis(trifluoromethyl)phenyl]-4-methyl-2-oxazolidinone, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 50g, 25g, 5g, 100mg, 250mg, 500mg.
(4S,5S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one (CAS 875444-06-7) is a chemical compound with the molecular formula C12H9F6NO2 and a molecular weight of 313.20 g/mol. IUPAC name: (4S,5S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one. InChIKey: OHIDCVTXTYVGRO-SSDLBLMSSA-N.
| Molecular formula | C12H9F6NO2 |
|---|---|
| Molecular weight | 313.20 g/mol |
| IUPAC name | (4S,5S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one |
| InChIKey | OHIDCVTXTYVGRO-SSDLBLMSSA-N |
| SMILES | C[C@H]1[C@@H](OC(=O)N1)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)